C23H35N3O2 — CID 71884962
1-[1-(4-morpholin-4-ylphenyl)ethyl]-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)urea (PubChem CID 71884962) has the molecular formula C23H35N3O2 and a molecular weight of 385.55 g/mol. Its IUPAC name is 1-[1-(4-morpholin-4-ylphenyl)ethyl]-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)urea.
| Compound Name | 1-[1-(4-morpholin-4-ylphenyl)ethyl]-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)urea |
|---|---|
| PubChem CID | 71884962 |
| Molecular Formula | C23H35N3O2 |
| Molecular Weight | 385.55 g/mol |
| Exact Mass | 385.27 |
| IUPAC Name | 1-[1-(4-morpholin-4-ylphenyl)ethyl]-3-(1,7,7-trimethyl-2-bicyclo[2.2.1]heptanyl)urea |
| SMILES | CC(NC(=O)NC1CC2CCC1(C)C2(C)C)c1ccc(N2CCOCC2)cc1 |
| InChI | InChI=1S/C23H35N3O2/c1-16(17-5-7-19(8-6-17)26-11-13-28-14-12-26)24-21(27)25-20-15-18-9-10-23(20,4)22(18,2)3/h5-8,16,18,20H,9-15H2,1-4H3,(H2,24,25,27) |
| InChIKey | DCAIPDVOFQLIRP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.55 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|