C22H29N5O — CID 139523360
3-methyl-N-[(1R)-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-2,3-dihydroimidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 139523360) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is 3-methyl-N-[(1R)-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-2,3-dihydroimidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | 3-methyl-N-[(1R)-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-2,3-dihydroimidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139523360 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | 3-methyl-N-[(1R)-1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]-2,3-dihydroimidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CC1C(C(=O)N[C@H](C)c2ccc(N3CCN(C)CC3)cc2)N=C2C=CC=CN21 |
| InChI | InChI=1S/C22H29N5O/c1-16(18-7-9-19(10-8-18)26-14-12-25(3)13-15-26)23-22(28)21-17(2)27-11-5-4-6-20(27)24-21/h4-11,16-17,21H,12-15H2,1-3H3,(H,23,28)/t16-,17?,21?/m1/s1 |
| InChIKey | HNBWWHJRIQSDFJ-ZGGTZUKQSA-N |
| XLogP | 2.17 |
| TPSA | 51.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|