C21H25N5O — CID 139507620
N-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 139507620) has the molecular formula C21H25N5O and a molecular weight of 363.47 g/mol. Its IUPAC name is N-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | N-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 139507620 |
| Molecular Formula | C21H25N5O |
| Molecular Weight | 363.47 g/mol |
| Exact Mass | 363.21 |
| IUPAC Name | N-[1-[4-(4-methylpiperazin-1-yl)phenyl]ethyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CC(NC(=O)c1cn2ccccc2n1)c1ccc(N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C21H25N5O/c1-16(22-21(27)19-15-26-10-4-3-5-20(26)23-19)17-6-8-18(9-7-17)25-13-11-24(2)12-14-25/h3-10,15-16H,11-14H2,1-2H3,(H,22,27) |
| InChIKey | FXNIFKPNWDNLHE-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.47 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|