C22H29N5O — CID 153344844
ethane;N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]imidazo[1,2-a]pyridine-2-carboxamide (PubChem CID 153344844) has the molecular formula C22H29N5O and a molecular weight of 379.51 g/mol. Its IUPAC name is ethane;N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]imidazo[1,2-a]pyridine-2-carboxamide.
| Compound Name | ethane;N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]imidazo[1,2-a]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 153344844 |
| Molecular Formula | C22H29N5O |
| Molecular Weight | 379.51 g/mol |
| Exact Mass | 379.24 |
| IUPAC Name | ethane;N-[[4-(4-methylpiperazin-1-yl)phenyl]methyl]imidazo[1,2-a]pyridine-2-carboxamide |
| SMILES | CC.CN1CCN(c2ccc(CNC(=O)c3cn4ccccc4n3)cc2)CC1 |
| InChI | InChI=1S/C20H23N5O.C2H6/c1-23-10-12-24(13-11-23)17-7-5-16(6-8-17)14-21-20(26)18-15-25-9-3-2-4-19(25)22-18;1-2/h2-9,15H,10-14H2,1H3,(H,21,26);1-2H3 |
| InChIKey | NKOGQURZIHXCJN-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 52.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.51 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|