C14H19N3O — CID 69363809
5-(1,4-diazepan-1-yl)-2-methyl-3H-isoindol-1-one (PubChem CID 69363809) has the molecular formula C14H19N3O and a molecular weight of 245.33 g/mol. Its IUPAC name is 5-(1,4-diazepan-1-yl)-2-methyl-3H-isoindol-1-one.
| Compound Name | 5-(1,4-diazepan-1-yl)-2-methyl-3H-isoindol-1-one |
|---|---|
| PubChem CID | 69363809 |
| Molecular Formula | C14H19N3O |
| Molecular Weight | 245.33 g/mol |
| Exact Mass | 245.15 |
| IUPAC Name | 5-(1,4-diazepan-1-yl)-2-methyl-3H-isoindol-1-one |
| SMILES | CN1Cc2cc(N3CCCNCC3)ccc2C1=O |
| InChI | InChI=1S/C14H19N3O/c1-16-10-11-9-12(3-4-13(11)14(16)18)17-7-2-5-15-6-8-17/h3-4,9,15H,2,5-8,10H2,1H3 |
| InChIKey | IWWRCPRDGVTPMC-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.33 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |