C22H28N2O3 — CID 156883313
5-(methylamino)-2-[3-oxo-6-(4-propoxybut-1-ynyl)-1H-isoindol-2-yl]hex-5-enal (PubChem CID 156883313) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 5-(methylamino)-2-[3-oxo-6-(4-propoxybut-1-ynyl)-1H-isoindol-2-yl]hex-5-enal.
| Compound Name | 5-(methylamino)-2-[3-oxo-6-(4-propoxybut-1-ynyl)-1H-isoindol-2-yl]hex-5-enal |
|---|---|
| PubChem CID | 156883313 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 5-(methylamino)-2-[3-oxo-6-(4-propoxybut-1-ynyl)-1H-isoindol-2-yl]hex-5-enal |
| SMILES | C=C(CCC(C=O)N1Cc2cc(C#CCCOCCC)ccc2C1=O)NC |
| InChI | InChI=1S/C22H28N2O3/c1-4-12-27-13-6-5-7-18-9-11-21-19(14-18)15-24(22(21)26)20(16-25)10-8-17(2)23-3/h9,11,14,16,20,23H,2,4,6,8,10,12-13,15H2,1,3H3 |
| InChIKey | WTBDPJKUPTTYGO-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|