C16H22N4O2 — CID 172569732
4-[6-(2,6-diazaspiro[3.3]heptan-2-yl)-3-pyridinyl]-N-methyl-5-oxopentanamide (PubChem CID 172569732) has the molecular formula C16H22N4O2 and a molecular weight of 302.38 g/mol. Its IUPAC name is 4-[6-(2,6-diazaspiro[3.3]heptan-2-yl)-3-pyridinyl]-N-methyl-5-oxopentanamide.
| Compound Name | 4-[6-(2,6-diazaspiro[3.3]heptan-2-yl)-3-pyridinyl]-N-methyl-5-oxopentanamide |
|---|---|
| PubChem CID | 172569732 |
| Molecular Formula | C16H22N4O2 |
| Molecular Weight | 302.38 g/mol |
| Exact Mass | 302.17 |
| IUPAC Name | 4-[6-(2,6-diazaspiro[3.3]heptan-2-yl)-3-pyridinyl]-N-methyl-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)c1ccc(N2CC3(CNC3)C2)nc1 |
| InChI | InChI=1S/C16H22N4O2/c1-17-15(22)5-3-13(7-21)12-2-4-14(19-6-12)20-10-16(11-20)8-18-9-16/h2,4,6-7,13,18H,3,5,8-11H2,1H3,(H,17,22) |
| InChIKey | UUZDUHKESABTFB-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.38 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|