C18H24N2O2 — CID 166113297
N-methyl-4-[4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-5-oxopentanamide (PubChem CID 166113297) has the molecular formula C18H24N2O2 and a molecular weight of 300.40 g/mol. Its IUPAC name is N-methyl-4-[4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-5-oxopentanamide.
| Compound Name | N-methyl-4-[4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-5-oxopentanamide |
|---|---|
| PubChem CID | 166113297 |
| Molecular Formula | C18H24N2O2 |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.18 |
| IUPAC Name | N-methyl-4-[4-(1-methyl-3,6-dihydro-2H-pyridin-4-yl)phenyl]-5-oxopentanamide |
| SMILES | CNC(=O)CCC(C=O)c1ccc(C2=CCN(C)CC2)cc1 |
| InChI | InChI=1S/C18H24N2O2/c1-19-18(22)8-7-17(13-21)15-5-3-14(4-6-15)16-9-11-20(2)12-10-16/h3-6,9,13,17H,7-8,10-12H2,1-2H3,(H,19,22) |
| InChIKey | PZOFJROWJXJSAC-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|