C15H20BrN3O — CID 54317266
4-[4-(4-bromophenyl)-3,6-dihydro-2H-pyridin-1-yl]butanehydrazide (PubChem CID 54317266) has the molecular formula C15H20BrN3O and a molecular weight of 338.25 g/mol. Its IUPAC name is 4-[4-(4-bromophenyl)-3,6-dihydro-2H-pyridin-1-yl]butanehydrazide.
| Compound Name | 4-[4-(4-bromophenyl)-3,6-dihydro-2H-pyridin-1-yl]butanehydrazide |
|---|---|
| PubChem CID | 54317266 |
| Molecular Formula | C15H20BrN3O |
| Molecular Weight | 338.25 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | 4-[4-(4-bromophenyl)-3,6-dihydro-2H-pyridin-1-yl]butanehydrazide |
| SMILES | NNC(=O)CCCN1CC=C(c2ccc(Br)cc2)CC1 |
| InChI | InChI=1S/C15H20BrN3O/c16-14-5-3-12(4-6-14)13-7-10-19(11-8-13)9-1-2-15(20)18-17/h3-7H,1-2,8-11,17H2,(H,18,20) |
| InChIKey | SPCKLQFLDIHGJX-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.25 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|