C16H24N4O2 — CID 176947846
4-(6-amino-1-methylindazol-3-yl)-N-methyl-5-oxopentanamide;ethane (PubChem CID 176947846) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-(6-amino-1-methylindazol-3-yl)-N-methyl-5-oxopentanamide;ethane.
| Compound Name | 4-(6-amino-1-methylindazol-3-yl)-N-methyl-5-oxopentanamide;ethane |
|---|---|
| PubChem CID | 176947846 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | 4-(6-amino-1-methylindazol-3-yl)-N-methyl-5-oxopentanamide;ethane |
| SMILES | CC.CNC(=O)CCC(C=O)c1nn(C)c2cc(N)ccc12 |
| InChI | InChI=1S/C14H18N4O2.C2H6/c1-16-13(20)6-3-9(8-19)14-11-5-4-10(15)7-12(11)18(2)17-14;1-2/h4-5,7-9H,3,6,15H2,1-2H3,(H,16,20);1-2H3 |
| InChIKey | CJKXCUFRRYQWCB-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|