C24H38N4O5 — CID 156799215
ethane;methanol;2-[1-[1-methyl-3-[5-(methylamino)-1,5-dioxopentan-2-yl]indazol-6-yl]piperidin-4-yl]acetic acid (PubChem CID 156799215) has the molecular formula C24H38N4O5 and a molecular weight of 462.59 g/mol. Its IUPAC name is ethane;methanol;2-[1-[1-methyl-3-[5-(methylamino)-1,5-dioxopentan-2-yl]indazol-6-yl]piperidin-4-yl]acetic acid.
| Compound Name | ethane;methanol;2-[1-[1-methyl-3-[5-(methylamino)-1,5-dioxopentan-2-yl]indazol-6-yl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 156799215 |
| Molecular Formula | C24H38N4O5 |
| Molecular Weight | 462.59 g/mol |
| Exact Mass | 462.28 |
| IUPAC Name | ethane;methanol;2-[1-[1-methyl-3-[5-(methylamino)-1,5-dioxopentan-2-yl]indazol-6-yl]piperidin-4-yl]acetic acid |
| SMILES | CC.CNC(=O)CCC(C=O)c1nn(C)c2cc(N3CCC(CC(=O)O)CC3)ccc12.CO |
| InChI | InChI=1S/C21H28N4O4.C2H6.CH4O/c1-22-19(27)6-3-15(13-26)21-17-5-4-16(12-18(17)24(2)23-21)25-9-7-14(8-10-25)11-20(28)29;2*1-2/h4-5,12-15H,3,6-11H2,1-2H3,(H,22,27)(H,28,29);1-2H3;2H,1H3 |
| InChIKey | VGGHVHGWJHMXGB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.59 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|