C27H36N4O5 — CID 171786679
tert-butyl 3-[4-[3-(1,5-dioxopentan-2-yl)-1-methylindazol-6-yl]piperidine-1-carbonyl]azetidine-1-carboxylate (PubChem CID 171786679) has the molecular formula C27H36N4O5 and a molecular weight of 496.61 g/mol. Its IUPAC name is tert-butyl 3-[4-[3-(1,5-dioxopentan-2-yl)-1-methylindazol-6-yl]piperidine-1-carbonyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[4-[3-(1,5-dioxopentan-2-yl)-1-methylindazol-6-yl]piperidine-1-carbonyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 171786679 |
| Molecular Formula | C27H36N4O5 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.27 |
| IUPAC Name | tert-butyl 3-[4-[3-(1,5-dioxopentan-2-yl)-1-methylindazol-6-yl]piperidine-1-carbonyl]azetidine-1-carboxylate |
| SMILES | Cn1nc(C(C=O)CCC=O)c2ccc(C3CCN(C(=O)C4CN(C(=O)OC(C)(C)C)C4)CC3)cc21 |
| InChI | InChI=1S/C27H36N4O5/c1-27(2,3)36-26(35)31-15-21(16-31)25(34)30-11-9-18(10-12-30)19-7-8-22-23(14-19)29(4)28-24(22)20(17-33)6-5-13-32/h7-8,13-14,17-18,20-21H,5-6,9-12,15-16H2,1-4H3 |
| InChIKey | IQMTVQLIWGPQMZ-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 101.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|