C22H30N2O4 — CID 118378615
methyl 1,3-dimethyl-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indole-2-carboxylate (PubChem CID 118378615) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is methyl 1,3-dimethyl-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indole-2-carboxylate.
| Compound Name | methyl 1,3-dimethyl-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indole-2-carboxylate |
|---|---|
| PubChem CID | 118378615 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | methyl 1,3-dimethyl-5-[1-[(2-methylpropan-2-yl)oxycarbonyl]piperidin-4-yl]indole-2-carboxylate |
| SMILES | COC(=O)c1c(C)c2cc(C3CCN(C(=O)OC(C)(C)C)CC3)ccc2n1C |
| InChI | InChI=1S/C22H30N2O4/c1-14-17-13-16(7-8-18(17)23(5)19(14)20(25)27-6)15-9-11-24(12-10-15)21(26)28-22(2,3)4/h7-8,13,15H,9-12H2,1-6H3 |
| InChIKey | LUBNRJBBAFFVMV-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 60.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|