2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid

C13H19N3O2 — CID 66509632

IUPAC2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid
SMILESCc1cc(C)nc(N2CCC(CC(=O)O)CC2)n1
InChIInChI=1S/C13H19N3O2/c1-9-7-10(2)15-13(14-9)16-5-3-11(4-6-16)8-12(17)18/h7,11H,3-6,8H2,1-2H3,(H,17,18)
InChIKeyHATXAOARKUXWAI-UHFFFAOYSA-N
MW249.31 g/mol
LogP1.78
Rot. Bonds3

About 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid

2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid (PubChem CID 66509632) has the molecular formula C13H19N3O2 and a molecular weight of 249.31 g/mol. Its IUPAC name is 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid.

Molecular Properties

Compound Name2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid
PubChem CID66509632
Molecular FormulaC13H19N3O2
Molecular Weight249.31 g/mol
Exact Mass249.15
IUPAC Name2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid
SMILESCc1cc(C)nc(N2CCC(CC(=O)O)CC2)n1
InChIInChI=1S/C13H19N3O2/c1-9-7-10(2)15-13(14-9)16-5-3-11(4-6-16)8-12(17)18/h7,11H,3-6,8H2,1-2H3,(H,17,18)
InChIKeyHATXAOARKUXWAI-UHFFFAOYSA-N
XLogP1.78
TPSA66.32 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 51.78
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid?
The IUPAC name of 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid (CID 66509632) is 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid.
What is the SMILES notation for 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid?
The canonical SMILES for 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid is Cc1cc(C)nc(N2CCC(CC(=O)O)CC2)n1.
What is the InChIKey of 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid?
The InChIKey is HATXAOARKUXWAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3O2/c1-9-7-10(2)15-13(14-9)16-5-3-11(4-6-16)8-12(17)18/h7,11H,3-6,8H2,1-2H3,(H,17,18).
What are the key properties of 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid?
2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid has a molecular weight of 249.31 g/mol, XLogP of 1.78, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(4,6-dimethylpyrimidin-2-yl)piperidin-4-yl]acetic acid is sourced from PubChem (CID 66509632), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).