About bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone
bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone (PubChem CID 150598584) has the molecular formula C21H30N8O
and a molecular weight of 410.53 g/mol. Its IUPAC name is bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone |
| PubChem CID | 150598584 |
| Molecular Formula | C21H30N8O |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C)nc(N2CCN(C(=O)N3CCN(c4nc(C)cc(C)n4)CC3)CC2)n1 |
| InChI | InChI=1S/C21H30N8O/c1-15-13-16(2)23-19(22-15)26-5-9-28(10-6-26)21(30)29-11-7-27(8-12-29)20-24-17(3)14-18(4)25-20/h13-14H,5-12H2,1-4H3 |
| InChIKey | IRJSNKOSEPMRLL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone?
The IUPAC name of bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone (CID 150598584) is bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone.
What is the SMILES notation for bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone?
The canonical SMILES for bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone is Cc1cc(C)nc(N2CCN(C(=O)N3CCN(c4nc(C)cc(C)n4)CC3)CC2)n1.
What is the InChIKey of bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone?
The InChIKey is IRJSNKOSEPMRLL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H30N8O/c1-15-13-16(2)23-19(22-15)26-5-9-28(10-6-26)21(30)29-11-7-27(8-12-29)20-24-17(3)14-18(4)25-20/h13-14H,5-12H2,1-4H3.
What are the key properties of bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone?
bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone has a molecular weight of 410.53 g/mol, XLogP of 1.56, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone is sourced from PubChem (CID 150598584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).