C21H30N8O — CID 150598584
bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone (PubChem CID 150598584) has the molecular formula C21H30N8O and a molecular weight of 410.53 g/mol. Its IUPAC name is bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone.
| Compound Name | bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 150598584 |
| Molecular Formula | C21H30N8O |
| Molecular Weight | 410.53 g/mol |
| Exact Mass | 410.25 |
| IUPAC Name | bis[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]methanone |
| SMILES | Cc1cc(C)nc(N2CCN(C(=O)N3CCN(c4nc(C)cc(C)n4)CC3)CC2)n1 |
| InChI | InChI=1S/C21H30N8O/c1-15-13-16(2)23-19(22-15)26-5-9-28(10-6-26)21(30)29-11-7-27(8-12-29)20-24-17(3)14-18(4)25-20/h13-14H,5-12H2,1-4H3 |
| InChIKey | IRJSNKOSEPMRLL-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 81.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.53 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |