C17H24N4O — CID 146077638
[4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-(1-methylcyclopent-2-en-1-yl)methanone (PubChem CID 146077638) has the molecular formula C17H24N4O and a molecular weight of 300.41 g/mol. Its IUPAC name is [4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-(1-methylcyclopent-2-en-1-yl)methanone.
| Compound Name | [4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-(1-methylcyclopent-2-en-1-yl)methanone |
|---|---|
| PubChem CID | 146077638 |
| Molecular Formula | C17H24N4O |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.20 |
| IUPAC Name | [4-(4,6-dimethylpyrimidin-2-yl)piperazin-1-yl]-(1-methylcyclopent-2-en-1-yl)methanone |
| SMILES | Cc1cc(C)nc(N2CCN(C(=O)C3(C)C=CCC3)CC2)n1 |
| InChI | InChI=1S/C17H24N4O/c1-13-12-14(2)19-16(18-13)21-10-8-20(9-11-21)15(22)17(3)6-4-5-7-17/h4,6,12H,5,7-11H2,1-3H3 |
| InChIKey | FUUOZYHZAOGSDQ-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|