C19H29N3O2 — CID 170749039
2-(6-ethyl-1-methylindazol-3-yl)-N-methyl-5-oxopentanamide;propane (PubChem CID 170749039) has the molecular formula C19H29N3O2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 2-(6-ethyl-1-methylindazol-3-yl)-N-methyl-5-oxopentanamide;propane.
| Compound Name | 2-(6-ethyl-1-methylindazol-3-yl)-N-methyl-5-oxopentanamide;propane |
|---|---|
| PubChem CID | 170749039 |
| Molecular Formula | C19H29N3O2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.23 |
| IUPAC Name | 2-(6-ethyl-1-methylindazol-3-yl)-N-methyl-5-oxopentanamide;propane |
| SMILES | CCC.CCc1ccc2c(C(CCC=O)C(=O)NC)nn(C)c2c1 |
| InChI | InChI=1S/C16H21N3O2.C3H8/c1-4-11-7-8-12-14(10-11)19(3)18-15(12)13(6-5-9-20)16(21)17-2;1-3-2/h7-10,13H,4-6H2,1-3H3,(H,17,21);3H2,1-2H3 |
| InChIKey | NMFDAJXKPHMYAR-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|