C28H35N3O4 — CID 166701714
2-[7-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]pentanedial (PubChem CID 166701714) has the molecular formula C28H35N3O4 and a molecular weight of 477.61 g/mol. Its IUPAC name is 2-[7-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]pentanedial.
| Compound Name | 2-[7-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]pentanedial |
|---|---|
| PubChem CID | 166701714 |
| Molecular Formula | C28H35N3O4 |
| Molecular Weight | 477.61 g/mol |
| Exact Mass | 477.26 |
| IUPAC Name | 2-[7-[4-[4-(4-methoxyphenyl)piperazin-1-yl]butyl]-3-oxo-1H-isoindol-2-yl]pentanedial |
| SMILES | COc1ccc(N2CCN(CCCCc3cccc4c3CN(C(C=O)CCC=O)C4=O)CC2)cc1 |
| InChI | InChI=1S/C28H35N3O4/c1-35-25-12-10-23(11-13-25)30-17-15-29(16-18-30)14-3-2-6-22-7-4-9-26-27(22)20-31(28(26)34)24(21-33)8-5-19-32/h4,7,9-13,19,21,24H,2-3,5-6,8,14-18,20H2,1H3 |
| InChIKey | JASCSZFOUIEZPK-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.61 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|