C23H35N3O5 — CID 178056030
2-[7-[4-(dimethoxymethyl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]pentanedial;N-methylmethanamine (PubChem CID 178056030) has the molecular formula C23H35N3O5 and a molecular weight of 433.55 g/mol. Its IUPAC name is 2-[7-[4-(dimethoxymethyl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]pentanedial;N-methylmethanamine.
| Compound Name | 2-[7-[4-(dimethoxymethyl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]pentanedial;N-methylmethanamine |
|---|---|
| PubChem CID | 178056030 |
| Molecular Formula | C23H35N3O5 |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 2-[7-[4-(dimethoxymethyl)piperidin-1-yl]-3-oxo-1H-isoindol-2-yl]pentanedial;N-methylmethanamine |
| SMILES | CNC.COC(OC)C1CCN(c2cccc3c2CN(C(C=O)CCC=O)C3=O)CC1 |
| InChI | InChI=1S/C21H28N2O5.C2H7N/c1-27-21(28-2)15-8-10-22(11-9-15)19-7-3-6-17-18(19)13-23(20(17)26)16(14-25)5-4-12-24;1-3-2/h3,6-7,12,14-16,21H,4-5,8-11,13H2,1-2H3;3H,1-2H3 |
| InChIKey | MKARUVOLZLTVEW-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|