C26H35N3O3 — CID 175264068
2-[1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 175264068) has the molecular formula C26H35N3O3 and a molecular weight of 437.58 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 175264068 |
| Molecular Formula | C26H35N3O3 |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 437.27 |
| IUPAC Name | 2-[1-(3,4-dimethoxyphenyl)butyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | CCCC(c1ccc(OC)c(OC)c1)N1Cc2c(cccc2N2CCN(CC)CC2)C1=O |
| InChI | InChI=1S/C26H35N3O3/c1-5-8-22(19-11-12-24(31-3)25(17-19)32-4)29-18-21-20(26(29)30)9-7-10-23(21)28-15-13-27(6-2)14-16-28/h7,9-12,17,22H,5-6,8,13-16,18H2,1-4H3 |
| InChIKey | WAKCQIIQOIKTSC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 45.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |