C29H34N4O3 — CID 59868715
2-[(3-aminophenyl)-(3,4-dimethoxyphenyl)methyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one (PubChem CID 59868715) has the molecular formula C29H34N4O3 and a molecular weight of 486.62 g/mol. Its IUPAC name is 2-[(3-aminophenyl)-(3,4-dimethoxyphenyl)methyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one.
| Compound Name | 2-[(3-aminophenyl)-(3,4-dimethoxyphenyl)methyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 59868715 |
| Molecular Formula | C29H34N4O3 |
| Molecular Weight | 486.62 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 2-[(3-aminophenyl)-(3,4-dimethoxyphenyl)methyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one |
| SMILES | CCN1CCN(c2cccc3c2CN(C(c2cccc(N)c2)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C29H34N4O3/c1-4-31-13-15-32(16-14-31)25-10-6-9-23-24(25)19-33(29(23)34)28(20-7-5-8-22(30)17-20)21-11-12-26(35-2)27(18-21)36-3/h5-12,17-18,28H,4,13-16,19,30H2,1-3H3 |
| InChIKey | GBXGSZUMDCDUDB-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 71.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.62 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|