C28H37N3O5 — CID 67046112
2-[1-(3,4-dimethoxyphenyl)-4-ethoxybutyl]-4-(4-ethylpiperazin-1-yl)isoindole-1,3-dione (PubChem CID 67046112) has the molecular formula C28H37N3O5 and a molecular weight of 495.62 g/mol. Its IUPAC name is 2-[1-(3,4-dimethoxyphenyl)-4-ethoxybutyl]-4-(4-ethylpiperazin-1-yl)isoindole-1,3-dione.
| Compound Name | 2-[1-(3,4-dimethoxyphenyl)-4-ethoxybutyl]-4-(4-ethylpiperazin-1-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 67046112 |
| Molecular Formula | C28H37N3O5 |
| Molecular Weight | 495.62 g/mol |
| Exact Mass | 495.27 |
| IUPAC Name | 2-[1-(3,4-dimethoxyphenyl)-4-ethoxybutyl]-4-(4-ethylpiperazin-1-yl)isoindole-1,3-dione |
| SMILES | CCOCCCC(c1ccc(OC)c(OC)c1)N1C(=O)c2cccc(N3CCN(CC)CC3)c2C1=O |
| InChI | InChI=1S/C28H37N3O5/c1-5-29-14-16-30(17-15-29)23-10-7-9-21-26(23)28(33)31(27(21)32)22(11-8-18-36-6-2)20-12-13-24(34-3)25(19-20)35-4/h7,9-10,12-13,19,22H,5-6,8,11,14-18H2,1-4H3 |
| InChIKey | FDYDTJLGMCSVPA-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 71.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.62 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|