C36H44N4O6 — CID 140592615
N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-ethoxyacetamide (PubChem CID 140592615) has the molecular formula C36H44N4O6 and a molecular weight of 628.77 g/mol. Its IUPAC name is N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-ethoxyacetamide.
| Compound Name | N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-ethoxyacetamide |
|---|---|
| PubChem CID | 140592615 |
| Molecular Formula | C36H44N4O6 |
| Molecular Weight | 628.77 g/mol |
| Exact Mass | 628.33 |
| IUPAC Name | N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-ethoxyacetamide |
| SMILES | CCOCC(=O)NCCCC(c1ccc(OC)c(OC)c1)N1C(=O)c2cccc(N3CCN([C@H](C)c4ccccc4)CC3)c2C1=O |
| InChI | InChI=1S/C36H44N4O6/c1-5-46-24-33(41)37-18-10-15-29(27-16-17-31(44-3)32(23-27)45-4)40-35(42)28-13-9-14-30(34(28)36(40)43)39-21-19-38(20-22-39)25(2)26-11-7-6-8-12-26/h6-9,11-14,16-17,23,25,29H,5,10,15,18-22,24H2,1-4H3,(H,37,41)/t25-,29?/m1/s1 |
| InChIKey | QVXJDLHISOXLFC-MIJJZIGMSA-N |
| XLogP | 4.86 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.77 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|