C37H42N4O6S2 — CID 23627665
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-5-methylthiophene-2-sulfonamide (PubChem CID 23627665) has the molecular formula C37H42N4O6S2 and a molecular weight of 702.90 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-5-methylthiophene-2-sulfonamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-5-methylthiophene-2-sulfonamide |
|---|---|
| PubChem CID | 23627665 |
| Molecular Formula | C37H42N4O6S2 |
| Molecular Weight | 702.90 g/mol |
| Exact Mass | 702.25 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-5-methylthiophene-2-sulfonamide |
| SMILES | COc1ccc([C@@H](CCCNS(=O)(=O)c2ccc(C)s2)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H42N4O6S2/c1-25-15-18-34(48-25)49(44,45)38-19-9-14-30(28-16-17-32(46-3)33(24-28)47-4)41-36(42)29-12-8-13-31(35(29)37(41)43)40-22-20-39(21-23-40)26(2)27-10-6-5-7-11-27/h5-8,10-13,15-18,24,26,30,38H,9,14,19-23H2,1-4H3/t26-,30-/m1/s1 |
| InChIKey | KHKVNQMPXQJARH-PDDLMNHVSA-N |
| XLogP | 6.05 |
| TPSA | 108.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.90 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|