C35H42N4O6 — CID 91578746
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-2-methoxyacetamide (PubChem CID 91578746) has the molecular formula C35H42N4O6 and a molecular weight of 614.74 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-2-methoxyacetamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-2-methoxyacetamide |
|---|---|
| PubChem CID | 91578746 |
| Molecular Formula | C35H42N4O6 |
| Molecular Weight | 614.74 g/mol |
| Exact Mass | 614.31 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]-2-methoxyacetamide |
| SMILES | COCC(=O)NCCC[C@H](c1ccc(OC)c(OC)c1)N1C(=O)c2cccc(N3CCN(C(C)c4ccccc4)CC3)c2C1=O |
| InChI | InChI=1S/C35H42N4O6/c1-24(25-10-6-5-7-11-25)37-18-20-38(21-19-37)29-13-8-12-27-33(29)35(42)39(34(27)41)28(14-9-17-36-32(40)23-43-2)26-15-16-30(44-3)31(22-26)45-4/h5-8,10-13,15-16,22,24,28H,9,14,17-21,23H2,1-4H3,(H,36,40)/t24?,28-/m1/s1 |
| InChIKey | ZBPRPIFFAFZAJE-ITCMONMYSA-N |
| XLogP | 4.47 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.74 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|