C39H45N5O5 — CID 58295978
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2,5-dimethyl-1H-pyrrole-3-carboxamide (PubChem CID 58295978) has the molecular formula C39H45N5O5 and a molecular weight of 663.82 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2,5-dimethyl-1H-pyrrole-3-carboxamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2,5-dimethyl-1H-pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 58295978 |
| Molecular Formula | C39H45N5O5 |
| Molecular Weight | 663.82 g/mol |
| Exact Mass | 663.34 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2,5-dimethyl-1H-pyrrole-3-carboxamide |
| SMILES | COc1ccc([C@@H](CCCNC(=O)c2cc(C)[nH]c2C)N2C(=O)c3cccc(N4CCN([C@H](C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C39H45N5O5/c1-25-23-31(26(2)41-25)37(45)40-18-10-15-32(29-16-17-34(48-4)35(24-29)49-5)44-38(46)30-13-9-14-33(36(30)39(44)47)43-21-19-42(20-22-43)27(3)28-11-7-6-8-12-28/h6-9,11-14,16-17,23-24,27,32,41H,10,15,18-22H2,1-5H3,(H,40,45)/t27-,32-/m1/s1 |
| InChIKey | HPPLMMABKLDSNY-WXGMZPBLSA-N |
| XLogP | 6.08 |
| TPSA | 107.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.82 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|