C37H46N4O6 — CID 67046298
tert-butyl N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]carbamate (PubChem CID 67046298) has the molecular formula C37H46N4O6 and a molecular weight of 642.80 g/mol. Its IUPAC name is tert-butyl N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]carbamate.
| Compound Name | tert-butyl N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]carbamate |
|---|---|
| PubChem CID | 67046298 |
| Molecular Formula | C37H46N4O6 |
| Molecular Weight | 642.80 g/mol |
| Exact Mass | 642.34 |
| IUPAC Name | tert-butyl N-[4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]butyl]carbamate |
| SMILES | COc1ccc(C(CCCNC(=O)OC(C)(C)C)N2C(=O)c3cccc(N4CCN(C(C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H46N4O6/c1-25(26-12-8-7-9-13-26)39-20-22-40(23-21-39)30-15-10-14-28-33(30)35(43)41(34(28)42)29(16-11-19-38-36(44)47-37(2,3)4)27-17-18-31(45-5)32(24-27)46-6/h7-10,12-15,17-18,24-25,29H,11,16,19-23H2,1-6H3,(H,38,44) |
| InChIKey | NGGJCHLWJLXTQR-UHFFFAOYSA-N |
| XLogP | 6.23 |
| TPSA | 100.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.80 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|