C39H50N4O5 — CID 70314425
N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-methylhexanamide (PubChem CID 70314425) has the molecular formula C39H50N4O5 and a molecular weight of 654.85 g/mol. Its IUPAC name is N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-methylhexanamide.
| Compound Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-methylhexanamide |
|---|---|
| PubChem CID | 70314425 |
| Molecular Formula | C39H50N4O5 |
| Molecular Weight | 654.85 g/mol |
| Exact Mass | 654.38 |
| IUPAC Name | N-[(4R)-4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-[(1R)-1-phenylethyl]piperazin-1-yl]isoindol-2-yl]butyl]-2-methylhexanamide |
| SMILES | CCCCC(C)C(=O)NCCC[C@H](c1ccc(OC)c(OC)c1)N1C(=O)c2cccc(N3CCN([C@H](C)c4ccccc4)CC3)c2C1=O |
| InChI | InChI=1S/C39H50N4O5/c1-6-7-13-27(2)37(44)40-21-12-18-32(30-19-20-34(47-4)35(26-30)48-5)43-38(45)31-16-11-17-33(36(31)39(43)46)42-24-22-41(23-25-42)28(3)29-14-9-8-10-15-29/h8-11,14-17,19-20,26-28,32H,6-7,12-13,18,21-25H2,1-5H3,(H,40,44)/t27?,28-,32-/m1/s1 |
| InChIKey | QVNNMKMGQJKDHN-AIOSLELTSA-N |
| XLogP | 6.65 |
| TPSA | 91.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.85 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|