C30H33N5O5 — CID 67140614
4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]isoindol-2-yl]butanamide (PubChem CID 67140614) has the molecular formula C30H33N5O5 and a molecular weight of 543.62 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]isoindol-2-yl]butanamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]isoindol-2-yl]butanamide |
|---|---|
| PubChem CID | 67140614 |
| Molecular Formula | C30H33N5O5 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.25 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(pyridin-3-ylmethyl)piperazin-1-yl]isoindol-2-yl]butanamide |
| SMILES | COc1ccc(C(CCC(N)=O)N2C(=O)c3cccc(N4CCN(Cc5cccnc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C30H33N5O5/c1-39-25-10-8-21(17-26(25)40-2)23(9-11-27(31)36)35-29(37)22-6-3-7-24(28(22)30(35)38)34-15-13-33(14-16-34)19-20-5-4-12-32-18-20/h3-8,10,12,17-18,23H,9,11,13-16,19H2,1-2H3,(H2,31,36) |
| InChIKey | GLNROKNIFPXCCA-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|