C37H39N5O5 — CID 174578134
4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]-2-pyridin-4-ylbutanamide (PubChem CID 174578134) has the molecular formula C37H39N5O5 and a molecular weight of 633.75 g/mol. Its IUPAC name is 4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]-2-pyridin-4-ylbutanamide.
| Compound Name | 4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]-2-pyridin-4-ylbutanamide |
|---|---|
| PubChem CID | 174578134 |
| Molecular Formula | C37H39N5O5 |
| Molecular Weight | 633.75 g/mol |
| Exact Mass | 633.30 |
| IUPAC Name | 4-(3,4-dimethoxyphenyl)-4-[1,3-dioxo-4-[4-(1-phenylethyl)piperazin-1-yl]isoindol-2-yl]-2-pyridin-4-ylbutanamide |
| SMILES | COc1ccc(C(CC(C(N)=O)c2ccncc2)N2C(=O)c3cccc(N4CCN(C(C)c5ccccc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C37H39N5O5/c1-24(25-8-5-4-6-9-25)40-18-20-41(21-19-40)30-11-7-10-28-34(30)37(45)42(36(28)44)31(27-12-13-32(46-2)33(22-27)47-3)23-29(35(38)43)26-14-16-39-17-15-26/h4-17,22,24,29,31H,18-21,23H2,1-3H3,(H2,38,43) |
| InChIKey | YSUIAKPZCYDTRY-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 118.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|