C29H34N4O5 — CID 67140224
2-[4-amino-1-(3,4-dimethoxyphenyl)butyl]-4-[4-(furan-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 67140224) has the molecular formula C29H34N4O5 and a molecular weight of 518.61 g/mol. Its IUPAC name is 2-[4-amino-1-(3,4-dimethoxyphenyl)butyl]-4-[4-(furan-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[4-amino-1-(3,4-dimethoxyphenyl)butyl]-4-[4-(furan-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67140224 |
| Molecular Formula | C29H34N4O5 |
| Molecular Weight | 518.61 g/mol |
| Exact Mass | 518.25 |
| IUPAC Name | 2-[4-amino-1-(3,4-dimethoxyphenyl)butyl]-4-[4-(furan-3-ylmethyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccc(C(CCCN)N2C(=O)c3cccc(N4CCN(Cc5ccoc5)CC4)c3C2=O)cc1OC |
| InChI | InChI=1S/C29H34N4O5/c1-36-25-9-8-21(17-26(25)37-2)23(7-4-11-30)33-28(34)22-5-3-6-24(27(22)29(33)35)32-14-12-31(13-15-32)18-20-10-16-38-19-20/h3,5-6,8-10,16-17,19,23H,4,7,11-15,18,30H2,1-2H3 |
| InChIKey | NVTPOBTXFKMUAQ-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 101.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.61 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|