C25H33N3O5 — CID 67140204
2-[4-amino-1-(3,4-dimethoxyphenyl)butyl]-4-[3-(dimethylamino)propoxy]isoindole-1,3-dione (PubChem CID 67140204) has the molecular formula C25H33N3O5 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-[4-amino-1-(3,4-dimethoxyphenyl)butyl]-4-[3-(dimethylamino)propoxy]isoindole-1,3-dione.
| Compound Name | 2-[4-amino-1-(3,4-dimethoxyphenyl)butyl]-4-[3-(dimethylamino)propoxy]isoindole-1,3-dione |
|---|---|
| PubChem CID | 67140204 |
| Molecular Formula | C25H33N3O5 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.24 |
| IUPAC Name | 2-[4-amino-1-(3,4-dimethoxyphenyl)butyl]-4-[3-(dimethylamino)propoxy]isoindole-1,3-dione |
| SMILES | COc1ccc(C(CCCN)N2C(=O)c3cccc(OCCCN(C)C)c3C2=O)cc1OC |
| InChI | InChI=1S/C25H33N3O5/c1-27(2)14-7-15-33-21-10-5-8-18-23(21)25(30)28(24(18)29)19(9-6-13-26)17-11-12-20(31-3)22(16-17)32-4/h5,8,10-12,16,19H,6-7,9,13-15,26H2,1-4H3 |
| InChIKey | WOEUEVHUSDIAPU-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 94.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|