C21H23NO6 — CID 56988950
4-hydroxy-2-[3-hydroxy-1-(4-methoxy-3-propoxyphenyl)propyl]isoindole-1,3-dione (PubChem CID 56988950) has the molecular formula C21H23NO6 and a molecular weight of 385.42 g/mol. Its IUPAC name is 4-hydroxy-2-[3-hydroxy-1-(4-methoxy-3-propoxyphenyl)propyl]isoindole-1,3-dione.
| Compound Name | 4-hydroxy-2-[3-hydroxy-1-(4-methoxy-3-propoxyphenyl)propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 56988950 |
| Molecular Formula | C21H23NO6 |
| Molecular Weight | 385.42 g/mol |
| Exact Mass | 385.15 |
| IUPAC Name | 4-hydroxy-2-[3-hydroxy-1-(4-methoxy-3-propoxyphenyl)propyl]isoindole-1,3-dione |
| SMILES | CCCOc1cc(C(CCO)N2C(=O)c3cccc(O)c3C2=O)ccc1OC |
| InChI | InChI=1S/C21H23NO6/c1-3-11-28-18-12-13(7-8-17(18)27-2)15(9-10-23)22-20(25)14-5-4-6-16(24)19(14)21(22)26/h4-8,12,15,23-24H,3,9-11H2,1-2H3 |
| InChIKey | LIIXMNARHWPKOM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|