C31H42N4O6 — CID 174563408
[(7R)-7-(3,4-dimethoxyphenyl)-7-[4-(4-ethylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]-2-methylheptan-2-yl] carbamate (PubChem CID 174563408) has the molecular formula C31H42N4O6 and a molecular weight of 566.70 g/mol. Its IUPAC name is [(7R)-7-(3,4-dimethoxyphenyl)-7-[4-(4-ethylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]-2-methylheptan-2-yl] carbamate.
| Compound Name | [(7R)-7-(3,4-dimethoxyphenyl)-7-[4-(4-ethylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]-2-methylheptan-2-yl] carbamate |
|---|---|
| PubChem CID | 174563408 |
| Molecular Formula | C31H42N4O6 |
| Molecular Weight | 566.70 g/mol |
| Exact Mass | 566.31 |
| IUPAC Name | [(7R)-7-(3,4-dimethoxyphenyl)-7-[4-(4-ethylpiperazin-1-yl)-1,3-dioxoisoindol-2-yl]-2-methylheptan-2-yl] carbamate |
| SMILES | CCN1CCN(c2cccc3c2C(=O)N([C@H](CCCCC(C)(C)OC(N)=O)c2ccc(OC)c(OC)c2)C3=O)CC1 |
| InChI | InChI=1S/C31H42N4O6/c1-6-33-16-18-34(19-17-33)24-12-9-10-22-27(24)29(37)35(28(22)36)23(11-7-8-15-31(2,3)41-30(32)38)21-13-14-25(39-4)26(20-21)40-5/h9-10,12-14,20,23H,6-8,11,15-19H2,1-5H3,(H2,32,38)/t23-/m1/s1 |
| InChIKey | WITOGXWKBYDZMU-HSZRJFAPSA-N |
| XLogP | 4.62 |
| TPSA | 114.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.70 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|