C37H49N3O7 — CID 161285118
2-[(1R)-1-(3,4-dimethoxyphenyl)-4-hydroxybutyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one;4-phenylmethoxybutanoic acid (PubChem CID 161285118) has the molecular formula C37H49N3O7 and a molecular weight of 647.81 g/mol. Its IUPAC name is 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-hydroxybutyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one;4-phenylmethoxybutanoic acid.
| Compound Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-hydroxybutyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one;4-phenylmethoxybutanoic acid |
|---|---|
| PubChem CID | 161285118 |
| Molecular Formula | C37H49N3O7 |
| Molecular Weight | 647.81 g/mol |
| Exact Mass | 647.36 |
| IUPAC Name | 2-[(1R)-1-(3,4-dimethoxyphenyl)-4-hydroxybutyl]-4-(4-ethylpiperazin-1-yl)-3H-isoindol-1-one;4-phenylmethoxybutanoic acid |
| SMILES | CCN1CCN(c2cccc3c2CN([C@H](CCCO)c2ccc(OC)c(OC)c2)C3=O)CC1.O=C(O)CCCOCc1ccccc1 |
| InChI | InChI=1S/C26H35N3O4.C11H14O3/c1-4-27-12-14-28(15-13-27)23-8-5-7-20-21(23)18-29(26(20)31)22(9-6-16-30)19-10-11-24(32-2)25(17-19)33-3;12-11(13)7-4-8-14-9-10-5-2-1-3-6-10/h5,7-8,10-11,17,22,30H,4,6,9,12-16,18H2,1-3H3;1-3,5-6H,4,7-9H2,(H,12,13)/t22-;/m1./s1 |
| InChIKey | VFPMCNJLVVNIGU-VZYDHVRKSA-N |
| XLogP | 5.38 |
| TPSA | 112.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.81 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|