C23H28N4O5 — CID 169257977
2-[1,3-dioxo-4-[4-(piperazine-1-carbonyl)piperidin-1-yl]isoindol-2-yl]pentanedial (PubChem CID 169257977) has the molecular formula C23H28N4O5 and a molecular weight of 440.50 g/mol. Its IUPAC name is 2-[1,3-dioxo-4-[4-(piperazine-1-carbonyl)piperidin-1-yl]isoindol-2-yl]pentanedial.
| Compound Name | 2-[1,3-dioxo-4-[4-(piperazine-1-carbonyl)piperidin-1-yl]isoindol-2-yl]pentanedial |
|---|---|
| PubChem CID | 169257977 |
| Molecular Formula | C23H28N4O5 |
| Molecular Weight | 440.50 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | 2-[1,3-dioxo-4-[4-(piperazine-1-carbonyl)piperidin-1-yl]isoindol-2-yl]pentanedial |
| SMILES | O=CCCC(C=O)N1C(=O)c2cccc(N3CCC(C(=O)N4CCNCC4)CC3)c2C1=O |
| InChI | InChI=1S/C23H28N4O5/c28-14-2-3-17(15-29)27-22(31)18-4-1-5-19(20(18)23(27)32)25-10-6-16(7-11-25)21(30)26-12-8-24-9-13-26/h1,4-5,14-17,24H,2-3,6-13H2 |
| InChIKey | ONILHINLWICWDQ-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 107.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.50 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|