C27H31N3O4S — CID 118755186
2-[2-(3-methoxyphenyl)ethyl]-4-[4-(thiomorpholine-4-carbonyl)piperidin-1-yl]isoindole-1,3-dione (PubChem CID 118755186) has the molecular formula C27H31N3O4S and a molecular weight of 493.63 g/mol. Its IUPAC name is 2-[2-(3-methoxyphenyl)ethyl]-4-[4-(thiomorpholine-4-carbonyl)piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-methoxyphenyl)ethyl]-4-[4-(thiomorpholine-4-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 118755186 |
| Molecular Formula | C27H31N3O4S |
| Molecular Weight | 493.63 g/mol |
| Exact Mass | 493.20 |
| IUPAC Name | 2-[2-(3-methoxyphenyl)ethyl]-4-[4-(thiomorpholine-4-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
| SMILES | COc1cccc(CCN2C(=O)c3cccc(N4CCC(C(=O)N5CCSCC5)CC4)c3C2=O)c1 |
| InChI | InChI=1S/C27H31N3O4S/c1-34-21-5-2-4-19(18-21)8-13-30-26(32)22-6-3-7-23(24(22)27(30)33)28-11-9-20(10-12-28)25(31)29-14-16-35-17-15-29/h2-7,18,20H,8-17H2,1H3 |
| InChIKey | PBECNYALSLAZTI-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.63 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|