C33H36N4O4 — CID 98340427
2-[2-(3-methoxyphenyl)ethyl]-4-[(3S)-3-[(2R)-2-pyridin-3-ylpiperidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione (PubChem CID 98340427) has the molecular formula C33H36N4O4 and a molecular weight of 552.68 g/mol. Its IUPAC name is 2-[2-(3-methoxyphenyl)ethyl]-4-[(3S)-3-[(2R)-2-pyridin-3-ylpiperidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(3-methoxyphenyl)ethyl]-4-[(3S)-3-[(2R)-2-pyridin-3-ylpiperidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 98340427 |
| Molecular Formula | C33H36N4O4 |
| Molecular Weight | 552.68 g/mol |
| Exact Mass | 552.27 |
| IUPAC Name | 2-[2-(3-methoxyphenyl)ethyl]-4-[(3S)-3-[(2R)-2-pyridin-3-ylpiperidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione |
| SMILES | COc1cccc(CCN2C(=O)c3cccc(N4CCC[C@H](C(=O)N5CCCC[C@@H]5c5cccnc5)C4)c3C2=O)c1 |
| InChI | InChI=1S/C33H36N4O4/c1-41-26-11-4-8-23(20-26)15-19-37-32(39)27-12-5-14-29(30(27)33(37)40)35-17-7-10-25(22-35)31(38)36-18-3-2-13-28(36)24-9-6-16-34-21-24/h4-6,8-9,11-12,14,16,20-21,25,28H,2-3,7,10,13,15,17-19,22H2,1H3/t25-,28+/m0/s1 |
| InChIKey | ONAKLUDZSJHBFY-LBNVMWSVSA-N |
| XLogP | 4.90 |
| TPSA | 83.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.68 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|