C30H37N3O4 — CID 45197715
4-[3-(2-ethylpiperidine-1-carbonyl)piperidin-1-yl]-2-[2-(3-methoxyphenyl)ethyl]isoindole-1,3-dione (PubChem CID 45197715) has the molecular formula C30H37N3O4 and a molecular weight of 503.64 g/mol. Its IUPAC name is 4-[3-(2-ethylpiperidine-1-carbonyl)piperidin-1-yl]-2-[2-(3-methoxyphenyl)ethyl]isoindole-1,3-dione.
| Compound Name | 4-[3-(2-ethylpiperidine-1-carbonyl)piperidin-1-yl]-2-[2-(3-methoxyphenyl)ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45197715 |
| Molecular Formula | C30H37N3O4 |
| Molecular Weight | 503.64 g/mol |
| Exact Mass | 503.28 |
| IUPAC Name | 4-[3-(2-ethylpiperidine-1-carbonyl)piperidin-1-yl]-2-[2-(3-methoxyphenyl)ethyl]isoindole-1,3-dione |
| SMILES | CCC1CCCCN1C(=O)C1CCCN(c2cccc3c2C(=O)N(CCc2cccc(OC)c2)C3=O)C1 |
| InChI | InChI=1S/C30H37N3O4/c1-3-23-11-4-5-17-32(23)28(34)22-10-8-16-31(20-22)26-14-7-13-25-27(26)30(36)33(29(25)35)18-15-21-9-6-12-24(19-21)37-2/h6-7,9,12-14,19,22-23H,3-5,8,10-11,15-18,20H2,1-2H3 |
| InChIKey | BTLBOYROEYSJLP-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.64 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|