C29H35N3O4 — CID 45241900
2-[2-(2-methoxyphenyl)ethyl]-4-[3-(4-methylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione (PubChem CID 45241900) has the molecular formula C29H35N3O4 and a molecular weight of 489.62 g/mol. Its IUPAC name is 2-[2-(2-methoxyphenyl)ethyl]-4-[3-(4-methylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[2-(2-methoxyphenyl)ethyl]-4-[3-(4-methylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45241900 |
| Molecular Formula | C29H35N3O4 |
| Molecular Weight | 489.62 g/mol |
| Exact Mass | 489.26 |
| IUPAC Name | 2-[2-(2-methoxyphenyl)ethyl]-4-[3-(4-methylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
| SMILES | COc1ccccc1CCN1C(=O)c2cccc(N3CCCC(C(=O)N4CCC(C)CC4)C3)c2C1=O |
| InChI | InChI=1S/C29H35N3O4/c1-20-12-16-30(17-13-20)27(33)22-8-6-15-31(19-22)24-10-5-9-23-26(24)29(35)32(28(23)34)18-14-21-7-3-4-11-25(21)36-2/h3-5,7,9-11,20,22H,6,8,12-19H2,1-2H3 |
| InChIKey | KOOPMHVZRFVJTD-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 70.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.62 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|