C30H37N3O5 — CID 42332170
(3R)-1-[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-dioxoisoindol-4-yl]-N-ethyl-N-(2-methylprop-2-enyl)piperidine-3-carboxamide (PubChem CID 42332170) has the molecular formula C30H37N3O5 and a molecular weight of 519.64 g/mol. Its IUPAC name is (3R)-1-[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-dioxoisoindol-4-yl]-N-ethyl-N-(2-methylprop-2-enyl)piperidine-3-carboxamide.
| Compound Name | (3R)-1-[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-dioxoisoindol-4-yl]-N-ethyl-N-(2-methylprop-2-enyl)piperidine-3-carboxamide |
|---|---|
| PubChem CID | 42332170 |
| Molecular Formula | C30H37N3O5 |
| Molecular Weight | 519.64 g/mol |
| Exact Mass | 519.27 |
| IUPAC Name | (3R)-1-[2-[2-(3,4-dimethoxyphenyl)ethyl]-1,3-dioxoisoindol-4-yl]-N-ethyl-N-(2-methylprop-2-enyl)piperidine-3-carboxamide |
| SMILES | C=C(C)CN(CC)C(=O)[C@@H]1CCCN(c2cccc3c2C(=O)N(CCc2ccc(OC)c(OC)c2)C3=O)C1 |
| InChI | InChI=1S/C30H37N3O5/c1-6-31(18-20(2)3)28(34)22-9-8-15-32(19-22)24-11-7-10-23-27(24)30(36)33(29(23)35)16-14-21-12-13-25(37-4)26(17-21)38-5/h7,10-13,17,22H,2,6,8-9,14-16,18-19H2,1,3-5H3/t22-/m1/s1 |
| InChIKey | DRSUOFHOLJZVAO-JOCHJYFZSA-N |
| XLogP | 4.18 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.64 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|