C31H32FN3O5 — CID 45168051
N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[2-[(3-fluorophenyl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide (PubChem CID 45168051) has the molecular formula C31H32FN3O5 and a molecular weight of 545.61 g/mol. Its IUPAC name is N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[2-[(3-fluorophenyl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide.
| Compound Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[2-[(3-fluorophenyl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45168051 |
| Molecular Formula | C31H32FN3O5 |
| Molecular Weight | 545.61 g/mol |
| Exact Mass | 545.23 |
| IUPAC Name | N-[2-(3,4-dimethoxyphenyl)ethyl]-1-[2-[(3-fluorophenyl)methyl]-1,3-dioxoisoindol-4-yl]piperidine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2CCCN(c3cccc4c3C(=O)N(Cc3cccc(F)c3)C4=O)C2)cc1OC |
| InChI | InChI=1S/C31H32FN3O5/c1-39-26-12-11-20(17-27(26)40-2)13-14-33-29(36)22-7-5-15-34(19-22)25-10-4-9-24-28(25)31(38)35(30(24)37)18-21-6-3-8-23(32)16-21/h3-4,6,8-12,16-17,22H,5,7,13-15,18-19H2,1-2H3,(H,33,36) |
| InChIKey | ZYURWIDBHXMDMM-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.61 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|