C31H27FN4O3S — CID 45200225
1-[2-[(3-fluorophenyl)methyl]-1,3-dioxoisoindol-4-yl]-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidine-3-carboxamide (PubChem CID 45200225) has the molecular formula C31H27FN4O3S and a molecular weight of 554.65 g/mol. Its IUPAC name is 1-[2-[(3-fluorophenyl)methyl]-1,3-dioxoisoindol-4-yl]-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-[(3-fluorophenyl)methyl]-1,3-dioxoisoindol-4-yl]-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45200225 |
| Molecular Formula | C31H27FN4O3S |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.18 |
| IUPAC Name | 1-[2-[(3-fluorophenyl)methyl]-1,3-dioxoisoindol-4-yl]-N-[(4-phenyl-1,3-thiazol-2-yl)methyl]piperidine-3-carboxamide |
| SMILES | O=C(NCc1nc(-c2ccccc2)cs1)C1CCCN(c2cccc3c2C(=O)N(Cc2cccc(F)c2)C3=O)C1 |
| InChI | InChI=1S/C31H27FN4O3S/c32-23-11-4-7-20(15-23)17-36-30(38)24-12-5-13-26(28(24)31(36)39)35-14-6-10-22(18-35)29(37)33-16-27-34-25(19-40-27)21-8-2-1-3-9-21/h1-5,7-9,11-13,15,19,22H,6,10,14,16-18H2,(H,33,37) |
| InChIKey | YBAZUVWREICTEL-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 82.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|