C30H32N4O3S — CID 45198682
4-[3-(2-methylpiperidine-1-carbonyl)piperidin-1-yl]-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione (PubChem CID 45198682) has the molecular formula C30H32N4O3S and a molecular weight of 528.68 g/mol. Its IUPAC name is 4-[3-(2-methylpiperidine-1-carbonyl)piperidin-1-yl]-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione.
| Compound Name | 4-[3-(2-methylpiperidine-1-carbonyl)piperidin-1-yl]-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45198682 |
| Molecular Formula | C30H32N4O3S |
| Molecular Weight | 528.68 g/mol |
| Exact Mass | 528.22 |
| IUPAC Name | 4-[3-(2-methylpiperidine-1-carbonyl)piperidin-1-yl]-2-[(4-phenyl-1,3-thiazol-2-yl)methyl]isoindole-1,3-dione |
| SMILES | CC1CCCCN1C(=O)C1CCCN(c2cccc3c2C(=O)N(Cc2nc(-c4ccccc4)cs2)C3=O)C1 |
| InChI | InChI=1S/C30H32N4O3S/c1-20-9-5-6-16-33(20)28(35)22-12-8-15-32(17-22)25-14-7-13-23-27(25)30(37)34(29(23)36)18-26-31-24(19-38-26)21-10-3-2-4-11-21/h2-4,7,10-11,13-14,19-20,22H,5-6,8-9,12,15-18H2,1H3 |
| InChIKey | UMNBMFJWTYZPPY-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.68 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|