C31H31N3O6 — CID 45189494
1-[2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-[2-(4-methoxyphenyl)ethyl]piperidine-3-carboxamide (PubChem CID 45189494) has the molecular formula C31H31N3O6 and a molecular weight of 541.60 g/mol. Its IUPAC name is 1-[2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-[2-(4-methoxyphenyl)ethyl]piperidine-3-carboxamide.
| Compound Name | 1-[2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-[2-(4-methoxyphenyl)ethyl]piperidine-3-carboxamide |
|---|---|
| PubChem CID | 45189494 |
| Molecular Formula | C31H31N3O6 |
| Molecular Weight | 541.60 g/mol |
| Exact Mass | 541.22 |
| IUPAC Name | 1-[2-(1,3-benzodioxol-5-ylmethyl)-1,3-dioxoisoindol-4-yl]-N-[2-(4-methoxyphenyl)ethyl]piperidine-3-carboxamide |
| SMILES | COc1ccc(CCNC(=O)C2CCCN(c3cccc4c3C(=O)N(Cc3ccc5c(c3)OCO5)C4=O)C2)cc1 |
| InChI | InChI=1S/C31H31N3O6/c1-38-23-10-7-20(8-11-23)13-14-32-29(35)22-4-3-15-33(18-22)25-6-2-5-24-28(25)31(37)34(30(24)36)17-21-9-12-26-27(16-21)40-19-39-26/h2,5-12,16,22H,3-4,13-15,17-19H2,1H3,(H,32,35) |
| InChIKey | OXQOMHKGQYBGCU-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 97.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.60 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|