C33H33N3O5 — CID 45221320
2-(1,3-benzodioxol-5-ylmethyl)-4-[4-(4-phenylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione (PubChem CID 45221320) has the molecular formula C33H33N3O5 and a molecular weight of 551.64 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-ylmethyl)-4-[4-(4-phenylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-[4-(4-phenylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 45221320 |
| Molecular Formula | C33H33N3O5 |
| Molecular Weight | 551.64 g/mol |
| Exact Mass | 551.24 |
| IUPAC Name | 2-(1,3-benzodioxol-5-ylmethyl)-4-[4-(4-phenylpiperidine-1-carbonyl)piperidin-1-yl]isoindole-1,3-dione |
| SMILES | O=C(C1CCN(c2cccc3c2C(=O)N(Cc2ccc4c(c2)OCO4)C3=O)CC1)N1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C33H33N3O5/c37-31(35-17-11-24(12-18-35)23-5-2-1-3-6-23)25-13-15-34(16-14-25)27-8-4-7-26-30(27)33(39)36(32(26)38)20-22-9-10-28-29(19-22)41-21-40-28/h1-10,19,24-25H,11-18,20-21H2 |
| InChIKey | DUFIPHNDHHKIGA-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 79.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.64 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|