C27H30FN3O4 — CID 42166810
2-[(3-fluorophenyl)methyl]-4-[4-[(3R)-3-(hydroxymethyl)piperidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione (PubChem CID 42166810) has the molecular formula C27H30FN3O4 and a molecular weight of 479.55 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-4-[4-[(3R)-3-(hydroxymethyl)piperidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3-fluorophenyl)methyl]-4-[4-[(3R)-3-(hydroxymethyl)piperidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42166810 |
| Molecular Formula | C27H30FN3O4 |
| Molecular Weight | 479.55 g/mol |
| Exact Mass | 479.22 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-4-[4-[(3R)-3-(hydroxymethyl)piperidine-1-carbonyl]piperidin-1-yl]isoindole-1,3-dione |
| SMILES | O=C(C1CCN(c2cccc3c2C(=O)N(Cc2cccc(F)c2)C3=O)CC1)N1CCC[C@@H](CO)C1 |
| InChI | InChI=1S/C27H30FN3O4/c28-21-6-1-4-18(14-21)16-31-26(34)22-7-2-8-23(24(22)27(31)35)29-12-9-20(10-13-29)25(33)30-11-3-5-19(15-30)17-32/h1-2,4,6-8,14,19-20,32H,3,5,9-13,15-17H2/t19-/m1/s1 |
| InChIKey | KTVAKTXMXHAZAA-LJQANCHMSA-N |
| XLogP | 3.07 |
| TPSA | 81.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.55 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|