C31H26FN3O3 — CID 42430357
2-[(3-fluorophenyl)methyl]-4-[4-(2-naphthalen-1-ylacetyl)piperazin-1-yl]isoindole-1,3-dione (PubChem CID 42430357) has the molecular formula C31H26FN3O3 and a molecular weight of 507.57 g/mol. Its IUPAC name is 2-[(3-fluorophenyl)methyl]-4-[4-(2-naphthalen-1-ylacetyl)piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-[(3-fluorophenyl)methyl]-4-[4-(2-naphthalen-1-ylacetyl)piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 42430357 |
| Molecular Formula | C31H26FN3O3 |
| Molecular Weight | 507.57 g/mol |
| Exact Mass | 507.20 |
| IUPAC Name | 2-[(3-fluorophenyl)methyl]-4-[4-(2-naphthalen-1-ylacetyl)piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C(Cc1cccc2ccccc12)N1CCN(c2cccc3c2C(=O)N(Cc2cccc(F)c2)C3=O)CC1 |
| InChI | InChI=1S/C31H26FN3O3/c32-24-10-3-6-21(18-24)20-35-30(37)26-12-5-13-27(29(26)31(35)38)33-14-16-34(17-15-33)28(36)19-23-9-4-8-22-7-1-2-11-25(22)23/h1-13,18H,14-17,19-20H2 |
| InChIKey | JDYWBYNPKBJECI-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.57 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|