C35H32N4O4 — CID 98223073
2-(naphthalen-1-ylmethyl)-4-[4-[2-[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]acetyl]piperazin-1-yl]isoindole-1,3-dione (PubChem CID 98223073) has the molecular formula C35H32N4O4 and a molecular weight of 572.67 g/mol. Its IUPAC name is 2-(naphthalen-1-ylmethyl)-4-[4-[2-[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]acetyl]piperazin-1-yl]isoindole-1,3-dione.
| Compound Name | 2-(naphthalen-1-ylmethyl)-4-[4-[2-[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]acetyl]piperazin-1-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 98223073 |
| Molecular Formula | C35H32N4O4 |
| Molecular Weight | 572.67 g/mol |
| Exact Mass | 572.24 |
| IUPAC Name | 2-(naphthalen-1-ylmethyl)-4-[4-[2-[(4R)-2-oxo-4-phenylpyrrolidin-1-yl]acetyl]piperazin-1-yl]isoindole-1,3-dione |
| SMILES | O=C(CN1C[C@@H](c2ccccc2)CC1=O)N1CCN(c2cccc3c2C(=O)N(Cc2cccc4ccccc24)C3=O)CC1 |
| InChI | InChI=1S/C35H32N4O4/c40-31-20-27(24-8-2-1-3-9-24)21-38(31)23-32(41)37-18-16-36(17-19-37)30-15-7-14-29-33(30)35(43)39(34(29)42)22-26-12-6-11-25-10-4-5-13-28(25)26/h1-15,27H,16-23H2/t27-/m0/s1 |
| InChIKey | ZHHAPYYYFWRYTL-MHZLTWQESA-N |
| XLogP | 4.30 |
| TPSA | 81.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.67 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|