C27H30ClN3O6 — CID 70359716
1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-(4-chlorophenyl)pyrrolidin-2-one;but-2-enedioic acid (PubChem CID 70359716) has the molecular formula C27H30ClN3O6 and a molecular weight of 528.01 g/mol. Its IUPAC name is 1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-(4-chlorophenyl)pyrrolidin-2-one;but-2-enedioic acid.
| Compound Name | 1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-(4-chlorophenyl)pyrrolidin-2-one;but-2-enedioic acid |
|---|---|
| PubChem CID | 70359716 |
| Molecular Formula | C27H30ClN3O6 |
| Molecular Weight | 528.01 g/mol |
| Exact Mass | 527.18 |
| IUPAC Name | 1-[2-(4-benzylpiperazin-1-yl)-2-oxoethyl]-4-(4-chlorophenyl)pyrrolidin-2-one;but-2-enedioic acid |
| SMILES | O=C(CN1CC(c2ccc(Cl)cc2)CC1=O)N1CCN(Cc2ccccc2)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C23H26ClN3O2.C4H4O4/c24-21-8-6-19(7-9-21)20-14-22(28)27(16-20)17-23(29)26-12-10-25(11-13-26)15-18-4-2-1-3-5-18;5-3(6)1-2-4(7)8/h1-9,20H,10-17H2;1-2H,(H,5,6)(H,7,8) |
| InChIKey | GKLCIYTVQWHCEP-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 118.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.01 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|